EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H14O2 |
| Net Charge | 0 |
| Average Mass | 142.198 |
| Monoisotopic Mass | 142.09938 |
| SMILES | CCC/C=C/COC(C)=O |
| InChI | InChI=1S/C8H14O2/c1-3-4-5-6-7-10-8(2)9/h5-6H,3-4,7H2,1-2H3/b6-5+ |
| InChIKey | HRHOWZHRCRZVCU-AATRIKPKSA-N |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| Application: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (E)-hex-2-enyl acetate (CHEBI:141209) has functional parent (E)-hex-2-en-1-ol (CHEBI:141205) |
| (E)-hex-2-enyl acetate (CHEBI:141209) has role flavouring agent (CHEBI:35617) |
| (E)-hex-2-enyl acetate (CHEBI:141209) has role plant metabolite (CHEBI:76924) |
| (E)-hex-2-enyl acetate (CHEBI:141209) is a acetate ester (CHEBI:47622) |
| (E)-hex-2-enyl acetate (CHEBI:141209) is a olefinic compound (CHEBI:78840) |
| IUPAC Name |
|---|
| (2E)-hex-2-en-1-yl acetate |
| Synonyms | Source |
|---|---|
| trans-2-hexen-1-yl acetate | ChemIDplus |
| trans-2-hexenyl acetate | ChemIDplus |
| (E)-2-hexenyl acetate | ChemIDplus |
| (E)-2-hexen-1-ol acetate | NIST Chemistry WebBook |
| trans-hex-2-en-1-yl acetate | NIST Chemistry WebBook |
| trans-hex-2-enyl acetate | NIST Chemistry WebBook |
| Manual Xrefs | Databases |
|---|---|
| HMDB0040212 | HMDB |
| LMFA07010178 | LIPID MAPS |
| FDB019924 | FooDB |
| C00035766 | KNApSAcK |
| Citations |
|---|