EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H56O10 |
| Net Charge | 0 |
| Average Mass | 612.801 |
| Monoisotopic Mass | 612.38735 |
| SMILES | [H][C@]1([C@H](C)CCCC(C)(C)O)CCC2C3C(C[C@@H](O)[C@@]21C)[C@@]1(C)CCC(O[C@@H]2O[C@H](C(=O)O)[C@@H](O)[C@@H](O)[C@H]2O)CC1C[C@@H]3O |
| InChI | InChI=1S/C33H56O10/c1-16(7-6-11-31(2,3)41)19-8-9-20-24-21(15-23(35)33(19,20)5)32(4)12-10-18(13-17(32)14-22(24)34)42-30-27(38)25(36)26(37)28(43-30)29(39)40/h16-28,30,34-38,41H,6-15H2,1-5H3,(H,39,40)/t16-,17?,18?,19-,20?,21?,22+,23-,24?,25-,26+,27-,28+,30-,32+,33-/m1/s1 |
| InChIKey | FHOADKVSESICIH-PTKXJPCFSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cholestane-3,7,12,25-tetrol-3-glucuronide (CHEBI:141204) is a steroid saponin (CHEBI:61655) |
| Manual Xrefs | Databases |
|---|---|
| 169878 | ChemSpider |