EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H7NO5 |
| Net Charge | 0 |
| Average Mass | 185.135 |
| Monoisotopic Mass | 185.03242 |
| SMILES | NC(/C=C\C(=O)O)=C/C(=O)C(=O)O |
| InChI | InChI=1S/C7H7NO5/c8-4(1-2-6(10)11)3-5(9)7(12)13/h1-3H,8H2,(H,10,11)(H,12,13)/b2-1-,4-3+ |
| InChIKey | SGUXCHHLXDUUHD-BXTBVDPRSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2Z,4E)-4-amino-6-oxohepta-2,4-dienedioic acid (CHEBI:141186) is a amino dicarboxylic acid (CHEBI:36164) |
| (2Z,4E)-4-amino-6-oxohepta-2,4-dienedioic acid (CHEBI:141186) is a dicarboxylic fatty acid (CHEBI:189840) |
| (2Z,4E)-4-amino-6-oxohepta-2,4-dienedioic acid (CHEBI:141186) is a enamine (CHEBI:47989) |
| (2Z,4E)-4-amino-6-oxohepta-2,4-dienedioic acid (CHEBI:141186) is a oxo dicarboxylic acid (CHEBI:36145) |
| (2Z,4E)-4-amino-6-oxohepta-2,4-dienedioic acid (CHEBI:141186) is conjugate acid of (2Z,4E)-4-amino-6-oxohepta-2,4-dienedioate (CHEBI:141047) |
| Incoming Relation(s) |
| (2Z,4E)-4-amino-6-oxohepta-2,4-dienedioate (CHEBI:141047) is conjugate base of (2Z,4E)-4-amino-6-oxohepta-2,4-dienedioic acid (CHEBI:141186) |
| IUPAC Name |
|---|
| (2Z,4E)-4-amino-6-oxohepta-2,4-dienedioic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:32861030 | Reaxys |
| Citations |
|---|