EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H7N3O2 |
| Net Charge | 0 |
| Average Mass | 141.130 |
| Monoisotopic Mass | 141.05383 |
| SMILES | Cc1ncc([N+](=O)[O-])n1C |
| InChI | InChI=1S/C5H7N3O2/c1-4-6-3-5(7(4)2)8(9)10/h3H,1-2H3 |
| InChIKey | IBXPYPUJPLLOIN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | antiprotozoal drug Any antimicrobial drug which is used to treat or prevent protozoal infections. |
| Applications: | antiparasitic agent A substance used to treat or prevent parasitic infections. antiprotozoal drug Any antimicrobial drug which is used to treat or prevent protozoal infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dimetridazole (CHEBI:141155) has role antiparasitic agent (CHEBI:35442) |
| dimetridazole (CHEBI:141155) has role antiprotozoal drug (CHEBI:35820) |
| dimetridazole (CHEBI:141155) is a C-nitro compound (CHEBI:35716) |
| dimetridazole (CHEBI:141155) is a imidazoles (CHEBI:24780) |
| IUPAC Name |
|---|
| 1,2-dimethyl-5-nitro-1H-imidazole |
| INNs | Source |
|---|---|
| dimetridazol | WHO MedNet |
| dimetridazole | ChemIDplus |
| dimétridazole | WHO MedNet |
| dimetridazolum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 1,2-Dimethyl-5-nitroimidazole | ChemIDplus |
| 5-Nitro-1,2-dimethylimidazole | ChemIDplus |
| Citations |
|---|