EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H8N4O4 |
| Net Charge | 0 |
| Average Mass | 200.154 |
| Monoisotopic Mass | 200.05455 |
| SMILES | Cn1c([N+](=O)[O-])cnc1COC(N)=O |
| InChI | InChI=1S/C6H8N4O4/c1-9-4(3-14-6(7)11)8-2-5(9)10(12)13/h2H,3H2,1H3,(H2,7,11) |
| InChIKey | PQFRTXSWDXZRRS-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | antiprotozoal drug Any antimicrobial drug which is used to treat or prevent protozoal infections. |
| Applications: | antiparasitic agent A substance used to treat or prevent parasitic infections. antiprotozoal drug Any antimicrobial drug which is used to treat or prevent protozoal infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ronidazole (CHEBI:141154) has role antiparasitic agent (CHEBI:35442) |
| ronidazole (CHEBI:141154) has role antiprotozoal drug (CHEBI:35820) |
| ronidazole (CHEBI:141154) is a C-nitro compound (CHEBI:35716) |
| ronidazole (CHEBI:141154) is a carbamate ester (CHEBI:23003) |
| ronidazole (CHEBI:141154) is a imidazoles (CHEBI:24780) |
| IUPAC Name |
|---|
| (1-methyl-5-nitro-1H-imidazol-2-yl)methyl carbamate |
| INNs | Source |
|---|---|
| ronidazole | ChemIDplus |
| ronidazol | ChemIDplus |
| ronidazole | WHO MedNet |
| ronidazolum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 1-methyl-5-nitro-1H-imidazole-2-methanol carbamate ester | ChEBI |
| carbamic acid (1-methyl-5-nitro-2-imidazolyl)methyl ester | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| Ronidazole | Wikipedia |
| D05752 | KEGG DRUG |
| 2406 | VSDB |
| Registry Numbers | Sources |
|---|---|
| CAS:7681-76-7 | ChemIDplus |
| Citations |
|---|