EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H17ClN6O2 |
| Net Charge | 0 |
| Average Mass | 396.838 |
| Monoisotopic Mass | 396.11015 |
| SMILES | Cc1cccc(-n2nnn(C)c2=O)c1COc1ccn(-c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C19H17ClN6O2/c1-13-4-3-5-17(26-19(27)24(2)22-23-26)16(13)12-28-18-10-11-25(21-18)15-8-6-14(20)7-9-15/h3-11H,12H2,1-2H3 |
| InChIKey | XUQQRGKFXLAPNV-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | quinone outside inhibitor A mitochondrial cytochrome-bc1 complex inhibitor that acts at the Quinone 'outer' (Qo) binding site of the cytochrome-bc1 complex. antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. |
| Applications: | quinone outside inhibitor A mitochondrial cytochrome-bc1 complex inhibitor that acts at the Quinone 'outer' (Qo) binding site of the cytochrome-bc1 complex. antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| metyltetraprole (CHEBI:141152) has role antifungal agrochemical (CHEBI:86328) |
| metyltetraprole (CHEBI:141152) has role quinone outside inhibitor (CHEBI:141153) |
| metyltetraprole (CHEBI:141152) is a monochlorobenzenes (CHEBI:83403) |
| metyltetraprole (CHEBI:141152) is a pyrazole pesticide (CHEBI:38601) |
| metyltetraprole (CHEBI:141152) is a tetrazoles (CHEBI:35689) |
| IUPAC Name |
|---|
| 1-[2-({[1-(4-chlorophenyl)-1H-pyrazol-3-yl]oxy}methyl)-3-methylphenyl]-4-methyl-1,4-dihydro-5H-tetrazol-5-one |
| Synonyms | Source |
|---|---|
| 1-(2-{[1-(4-chlorophenyl)-1H-pyrazol-3-yl]oxymethyl}-3-methylphenyl)-1,4-dihydro-4-methyl-5H-tetrazol-5-one | Alan Wood's Pesticides |
| 1-[2-[[[1-(4-chlorophenyl)-1H-pyrazol-3-yl]oxy]methyl]-3-methylphenyl]-1,4-dihydro-4-methyl-5H-tetrazol-5-one | Alan Wood's Pesticides |
| métyltétraprole | Alan Wood's Pesticides |
| Brand Name | Source |
|---|---|
| Pavecto | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| metyltetraprole | Alan Wood's Pesticides |
| Metyltetraprole | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:24085463 | Reaxys |
| CAS:1472649-01-6 | Alan Wood's Pesticides |