EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H13NO3 |
| Net Charge | 0 |
| Average Mass | 183.207 |
| Monoisotopic Mass | 183.08954 |
| SMILES | C[C@H](N)[C@H](O)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C9H13NO3/c1-5(10)9(13)6-2-3-7(11)8(12)4-6/h2-5,9,11-13H,10H2,1H3/t5-,9-/m0/s1 |
| InChIKey | GEFQWZLICWMTKF-CDUCUWFYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | alpha-adrenergic agonist An agent that selectively binds to and activates α-adrenergic receptors. |
| Applications: | alpha-adrenergic agonist An agent that selectively binds to and activates α-adrenergic receptors. nasal decongestant A drug used to relieve nasal congestion in the upper respiratory tract. vasoconstrictor agent Drug used to cause constriction of the blood vessels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| α-methylnoradrenaline (CHEBI:141146) has role nasal decongestant (CHEBI:77715) |
| α-methylnoradrenaline (CHEBI:141146) has role vasoconstrictor agent (CHEBI:50514) |
| α-methylnoradrenaline (CHEBI:141146) has role α-adrenergic agonist (CHEBI:35569) |
| α-methylnoradrenaline (CHEBI:141146) is a catecholamine (CHEBI:33567) |
| IUPAC Name |
|---|
| 4-(2-amino-1-hydroxypropyl)benzene-1,2-diol |
| INNs | Source |
|---|---|
| corbadrina | WHO MedNet |
| corbadrine | WHO MedNet |
| corbadrinum | WHO MedNet |
| Synonyms | Source |
|---|---|
| isoadrenaline | ChemIDplus |
| levonordefrin | ChemIDplus |
| Methylnoradrenaline | ChemIDplus |
| α-(1-aminoethyl)-3,4-dihydroxybenzyl alcohol | ChemIDplus |
| α-methylnorepinephrine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| Corbadrine | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3200344 | Reaxys |
| CAS:829-74-3 | ChemIDplus |
| Citations |
|---|