EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H24O12 |
| Net Charge | 0 |
| Average Mass | 516.455 |
| Monoisotopic Mass | 516.12678 |
| SMILES | O=C(/C=C/c1ccc(O)c(O)c1)O[C@H]1[C@H](O)C[C@](O)(C(=O)O)C[C@H]1OC(=O)/C=C/c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C25H24O12/c26-15-5-1-13(9-17(15)28)3-7-21(31)36-20-12-25(35,24(33)34)11-19(30)23(20)37-22(32)8-4-14-2-6-16(27)18(29)10-14/h1-10,19-20,23,26-30,35H,11-12H2,(H,33,34)/b7-3+,8-4+/t19-,20-,23+,25-/m1/s1 |
| InChIKey | UFCLZKMFXSILNL-RVXRWRFUSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4,5-di-O-caffeoylquinic acid (CHEBI:141136) is a quinic acid (CHEBI:26493) |
| 4,5-di-O-caffeoylquinic acid (CHEBI:141136) is conjugate acid of 4,5-di-O-caffeoyl quinate (CHEBI:232974) |
| Incoming Relation(s) |
| 4,5-di-O-caffeoyl quinate (CHEBI:232974) is conjugate base of 4,5-di-O-caffeoylquinic acid (CHEBI:141136) |
| Synonym | Source |
|---|---|
| Isochlorogenic acid c | ChEBI |