EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H22O14 |
| Net Charge | 0 |
| Average Mass | 534.426 |
| Monoisotopic Mass | 534.10096 |
| SMILES | O=C(O)[C@](O)(C(=O)/C=C/c1ccc(O)c(O)c1)[C@H](O)[C@H](O)[C@](O)(C(=O)O)C(=O)/C=C/c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C24H22O14/c25-13-5-1-11(9-15(13)27)3-7-17(29)23(37,21(33)34)19(31)20(32)24(38,22(35)36)18(30)8-4-12-2-6-14(26)16(28)10-12/h1-10,19-20,25-28,31-32,37-38H,(H,33,34)(H,35,36)/b7-3+,8-4+/t19-,20+,23-,24-/m0/s1 |
| InChIKey | SUFPHEGNGVNRLB-YFTNUIKYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,5-dicaffeoylaltraric acid (CHEBI:141133) is a dicaffeoylaltraric acid (CHEBI:147324) |