EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H12N4O5 |
| Net Charge | 0 |
| Average Mass | 244.207 |
| Monoisotopic Mass | 244.08077 |
| SMILES | Nc1ncn([C@@H]2O[C@H](CO)[C@@H](O)[C@@H]2O)c(=O)n1 |
| InChI | InChI=1S/C8H12N4O5/c9-7-10-2-12(8(16)11-7)6-5(15)4(14)3(1-13)17-6/h2-6,13-15H,1H2,(H2,9,11,16)/t3-,4-,5+,6-/m1/s1 |
| InChIKey | NMUSYJAQQFHJEW-ARQDHWQXSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fazarabine (CHEBI:141077) has functional parent β-D-arabinofuranose (CHEBI:79055) |
| fazarabine (CHEBI:141077) has role antineoplastic agent (CHEBI:35610) |
| fazarabine (CHEBI:141077) is a N-glycosyl-1,3,5-triazine (CHEBI:48009) |
| fazarabine (CHEBI:141077) is a nucleoside analogue (CHEBI:60783) |
| IUPAC Name |
|---|
| 4-amino-1-β-D-arabinofuranosyl-1,3,5-triazin-2(1H)-one |
| INNs | Source |
|---|---|
| fazarabine | ChemIDplus |
| fazarabinum | WHO MedNet |
| fazarabine | WHO MedNet |
| fazarabina | WHO MedNet |
| Synonyms | Source |
|---|---|
| 5-azacytarabine | ChEBI |
| 1-beta-D-Arabinofuranosyl-5-azacytosine | ChemIDplus |
| 4-Amino-1-beta-D-arabinofuranosyl-s-triazin-2(1H)-one | ChemIDplus |
| Ara-AC | ChemIDplus |
| 5-azacytosine arabinoside | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:620462 | Reaxys |
| CAS:65886-71-7 | ChemIDplus |
| Citations |
|---|