EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H20N6O6S |
| Net Charge | 0 |
| Average Mass | 424.439 |
| Monoisotopic Mass | 424.11650 |
| SMILES | COc1cc(OC)nc(NC(=O)NS(=O)(=O)Nc2ccccc2C(=O)N(C)C)n1 |
| InChI | InChI=1S/C16H20N6O6S/c1-22(2)14(23)10-7-5-6-8-11(10)20-29(25,26)21-16(24)19-15-17-12(27-3)9-13(18-15)28-4/h5-9,20H,1-4H3,(H2,17,18,19,21,24) |
| InChIKey | UCDPMNSCCRBWIC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 2.2.1.6 (acetolactate synthase) inhibitor An EC 2.2.1.* (transketolase/transaldolase) inhibitor that interferes with the action of acetolactate synthase (EC 2.2.1.6). |
| Application: | herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| orthosulfamuron (CHEBI:141068) has role EC 2.2.1.6 (acetolactate synthase) inhibitor (CHEBI:22180) |
| orthosulfamuron (CHEBI:141068) has role herbicide (CHEBI:24527) |
| orthosulfamuron (CHEBI:141068) is a N-sulfonylurea (CHEBI:76983) |
| orthosulfamuron (CHEBI:141068) is a aromatic ether (CHEBI:35618) |
| orthosulfamuron (CHEBI:141068) is a sulfuric amide (CHEBI:38038) |
| orthosulfamuron (CHEBI:141068) is a tertiary carboxamide (CHEBI:140326) |
| IUPAC Name |
|---|
| 2-({[(4,6-dimethoxypyrimidin-2-yl)carbamoyl]sulfamoyl}amino)-N,N-dimethylbenzamide |
| Synonyms | Source |
|---|---|
| 1-(4,6-dimethoxypyrimidin-2-yl)-3-[2-(dimethylcarbamoyl)phenylsulfamoyl]urea | Alan Wood's Pesticides |
| 2-[[[[[(4,6-dimethoxy-2-pyrimidinyl)amino]carbonyl]amino]sulfonyl]amino]-N,NN-dimethylbenzamide | Alan Wood's Pesticides |
| IR 5878 | ChemIDplus |
| Brand Names | Source |
|---|---|
| Strada | PPDB |
| Kelion | PPDB |
| Percutio | PPDB |
| Manual Xrefs | Databases |
|---|---|
| orthosulfamuron | Alan Wood's Pesticides |
| 1135 | PPDB |
| Registry Numbers | Sources |
|---|---|
| CAS:213464-77-8 | ChemIDplus |
| CAS:213464-77-8 | Alan Wood's Pesticides |
| Citations |
|---|