EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H16O4 |
| Net Charge | 0 |
| Average Mass | 284.311 |
| Monoisotopic Mass | 284.10486 |
| SMILES | COC(=O)c1c2c(c3ccccc3c1O)OC(C)(C)C=C2 |
| InChI | InChI=1S/C17H16O4/c1-17(2)9-8-12-13(16(19)20-3)14(18)10-6-4-5-7-11(10)15(12)21-17/h4-9,18H,1-3H3 |
| InChIKey | VLGATXOTCNBWIT-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rubia cordifolia (ncbitaxon:339321) | - | PubMed (19652367) |
| Roles Classification |
|---|
| Biological Roles: | NF-kappaB inhibitor An inhibitor of NF-κB (nuclear factor κ-light-chain-enhancer of activated B cells), a protein complex involved in the transcription of DNA. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. acyl-CoA:cholesterol acyltransferase 2 inhibitor A sterol O-acyltransferase inhibitor that specifically inhibits acyl-CoA:cholesterol acyltransferase 2. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rubimaillin (CHEBI:141063) has role acyl-CoA:cholesterol acyltransferase 2 inhibitor (CHEBI:64697) |
| rubimaillin (CHEBI:141063) has role anti-inflammatory agent (CHEBI:67079) |
| rubimaillin (CHEBI:141063) has role antineoplastic agent (CHEBI:35610) |
| rubimaillin (CHEBI:141063) has role apoptosis inducer (CHEBI:68495) |
| rubimaillin (CHEBI:141063) has role neuroprotective agent (CHEBI:63726) |
| rubimaillin (CHEBI:141063) has role NF-κB inhibitor (CHEBI:73240) |
| rubimaillin (CHEBI:141063) has role plant metabolite (CHEBI:76924) |
| rubimaillin (CHEBI:141063) is a benzochromene (CHEBI:38920) |
| rubimaillin (CHEBI:141063) is a methyl ester (CHEBI:25248) |
| rubimaillin (CHEBI:141063) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| methyl 6-hydroxy-2,2-dimethyl-2H-benzo[h]chromene-5-carboxylate |
| Synonym | Source |
|---|---|
| mollugin | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:55481-88-4 | ChemIDplus |
| Citations |
|---|