EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H5I2NO3 |
| Net Charge | 0 |
| Average Mass | 404.929 |
| Monoisotopic Mass | 404.83589 |
| SMILES | O=C(O)Cn1cc(I)c(=O)c(I)c1 |
| InChI | InChI=1S/C7H5I2NO3/c8-4-1-10(3-6(11)12)2-5(9)7(4)13/h1-2H,3H2,(H,11,12) |
| InChIKey | PVBALTLWZVEAIO-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | radioopaque medium A substance having the property of absorbing, and therefore being opaque to, electromagnetic radiation, particularly X-rays. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| diodone (CHEBI:141062) has functional parent α-amino acid (CHEBI:33704) |
| diodone (CHEBI:141062) has role radioopaque medium (CHEBI:37338) |
| diodone (CHEBI:141062) is a 4-pyridones (CHEBI:20485) |
| diodone (CHEBI:141062) is a monocarboxylic acid (CHEBI:25384) |
| diodone (CHEBI:141062) is a organic molecular entity (CHEBI:50860) |
| diodone (CHEBI:141062) is a organoiodine compound (CHEBI:37142) |
| diodone (CHEBI:141062) is a organonitrogen compound (CHEBI:35352) |
| diodone (CHEBI:141062) is a organooxygen compound (CHEBI:36963) |
| IUPAC Name |
|---|
| (3,5-diiodo-4-oxopiperidin-1-yl)acetic acid |
| Synonyms | Source |
|---|---|
| 3,5-diiodo-4-pyridone-1-acetic acid | ChEBI |
| diodone acid | ChEMBL |
| Diodone acid | ChemIDplus |
| NSC-60718 | ChEMBL |
| pelvirinic acid | ChemIDplus |
| umbradilic acid | ChemIDplus |
| Citations |
|---|