EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H36O5 |
| Net Charge | 0 |
| Average Mass | 380.525 |
| Monoisotopic Mass | 380.25627 |
| SMILES | CCCCC(C)(C)[C@H](O)/C=C/[C@H]1[C@H](O)CC(=O)[C@@H]1C/C=C\CCCC(=O)O |
| InChI | InChI=1S/C22H36O5/c1-4-5-14-22(2,3)20(25)13-12-17-16(18(23)15-19(17)24)10-8-6-7-9-11-21(26)27/h6,8,12-13,16-17,19-20,24-25H,4-5,7,9-11,14-15H2,1-3H3,(H,26,27)/b8-6-,13-12+/t16-,17-,19-,20-/m1/s1 |
| InChIKey | QAOBBBBDJSWHMU-WMBBNPMCSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Applications: | radiation protective agent Any compound that is able to protect normal cells from the damage caused by radiation therapy. anti-ulcer drug One of various classes of drugs with different action mechanisms used to treat or ameliorate peptic ulcer or irritation of the gastrointestinal tract. gastrointestinal drug A drug used for its effects on the gastrointestinal system, e.g. controlling gastric acidity, regulating gastrointestinal motility and water flow, and improving digestion. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 16,16-dimethylprostaglandin E2 (CHEBI:141046) has role anti-ulcer drug (CHEBI:49201) |
| 16,16-dimethylprostaglandin E2 (CHEBI:141046) has role gastrointestinal drug (CHEBI:55324) |
| 16,16-dimethylprostaglandin E2 (CHEBI:141046) has role radiation protective agent (CHEBI:66987) |
| 16,16-dimethylprostaglandin E2 (CHEBI:141046) is a cyclopentanones (CHEBI:36140) |
| 16,16-dimethylprostaglandin E2 (CHEBI:141046) is a monocarboxylic acid (CHEBI:25384) |
| 16,16-dimethylprostaglandin E2 (CHEBI:141046) is a prostanoid (CHEBI:26347) |
| 16,16-dimethylprostaglandin E2 (CHEBI:141046) is a secondary allylic alcohol (CHEBI:134396) |
| IUPAC Name |
|---|
| (5Z,11α,13E,15R)-11,15-dihydroxy-16,16-dimethyl-9-oxoprosta-5,13-dien-1-oic acid |
| Synonyms | Source |
|---|---|
| dmPGE2 | SUBMITTER |
| 16,16-dimethyl Prostaglandin E2 | ChEBI |
| dmPGE(2) | ChEBI |
| dmPGE2 | ChEBI |
| 16,16-Dimethyl-prostaglandin E2 | ChemIDplus |
| 16,16-Dimethyl-pge2 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| LMFA03010065 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| CAS:39746-25-3 | ChemIDplus |
| Citations |
|---|