EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H36O5 |
| Net Charge | 0 |
| Average Mass | 380.525 |
| Monoisotopic Mass | 380.25627 |
| SMILES | CCCCC(C)(C)[C@H](O)/C=C/[C@H]1[C@H](O)CC(=O)[C@@H]1C/C=C\CCCC(=O)O |
| InChI | InChI=1S/C22H36O5/c1-4-5-14-22(2,3)20(25)13-12-17-16(18(23)15-19(17)24)10-8-6-7-9-11-21(26)27/h6,8,12-13,16-17,19-20,24-25H,4-5,7,9-11,14-15H2,1-3H3,(H,26,27)/b8-6-,13-12+/t16-,17-,19-,20-/m1/s1 |
| InChIKey | QAOBBBBDJSWHMU-WMBBNPMCSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Applications: | gastrointestinal drug A drug used for its effects on the gastrointestinal system, e.g. controlling gastric acidity, regulating gastrointestinal motility and water flow, and improving digestion. radiation protective agent Any compound that is able to protect normal cells from the damage caused by radiation therapy. anti-ulcer drug One of various classes of drugs with different action mechanisms used to treat or ameliorate peptic ulcer or irritation of the gastrointestinal tract. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 16,16-dimethylprostaglandin E2 (CHEBI:141046) has role anti-ulcer drug (CHEBI:49201) |
| 16,16-dimethylprostaglandin E2 (CHEBI:141046) has role gastrointestinal drug (CHEBI:55324) |
| 16,16-dimethylprostaglandin E2 (CHEBI:141046) has role radiation protective agent (CHEBI:66987) |
| 16,16-dimethylprostaglandin E2 (CHEBI:141046) is a cyclopentanones (CHEBI:36140) |
| 16,16-dimethylprostaglandin E2 (CHEBI:141046) is a monocarboxylic acid (CHEBI:25384) |
| 16,16-dimethylprostaglandin E2 (CHEBI:141046) is a prostanoid (CHEBI:26347) |
| 16,16-dimethylprostaglandin E2 (CHEBI:141046) is a secondary allylic alcohol (CHEBI:134396) |
| IUPAC Name |
|---|
| (5Z,11α,13E,15R)-11,15-dihydroxy-16,16-dimethyl-9-oxoprosta-5,13-dien-1-oic acid |
| Synonyms | Source |
|---|---|
| 16,16-Dimethyl-pge2 | ChemIDplus |
| 16,16-dimethyl Prostaglandin E2 | ChEBI |
| 16,16-Dimethyl-prostaglandin E2 | ChemIDplus |
| 9-oxo-11R,15R-dihydroxy-16,16-dimethyl-5Z,13E-prostadienoic acid | LIPID MAPS |
| dmPGE(2) | ChEBI |
| dmPGE2 | SUBMITTER |
| Manual Xrefs | Databases |
|---|---|
| LMFA03010065 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| CAS:39746-25-3 | ChemIDplus |
| Citations |
|---|