EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H32N6O3 |
| Net Charge | 0 |
| Average Mass | 500.603 |
| Monoisotopic Mass | 500.25359 |
| SMILES | N=C(N)NCCC[C@@H](NC(=O)C(c1ccccc1)c1ccccc1)C(=O)N[C@@H](C(N)=O)c1ccccc1 |
| InChI | InChI=1S/C28H32N6O3/c29-25(35)24(21-15-8-3-9-16-21)34-26(36)22(17-10-18-32-28(30)31)33-27(37)23(19-11-4-1-5-12-19)20-13-6-2-7-14-20/h1-9,11-16,22-24H,10,17-18H2,(H2,29,35)(H,33,37)(H,34,36)(H4,30,31,32)/t22-,24-/m1/s1 |
| InChIKey | VREKBHVPVINEDT-ISKFKSNPSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | neuropeptide FF receptor antagonist An antagonist that binds to and deactivates neuropeptide FF receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| GJ14 (CHEBI:140979) has role neuropeptide FF receptor antagonist (CHEBI:140982) |
| GJ14 (CHEBI:140979) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| N-[(1R)-2-amino-2-oxo-1-phenylethyl]-N2-(diphenylacetyl)-D-argininamide |
| Synonym | Source |
|---|---|
| GJ-14 | SUBMITTER |
| Citations |
|---|