EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H14N4OS |
| Net Charge | 0 |
| Average Mass | 286.360 |
| Monoisotopic Mass | 286.08883 |
| SMILES | Cc1cc(NC(=O)Nc2ccc3c(ccn3C)c2)sn1 |
| InChI | InChI=1S/C14H14N4OS/c1-9-7-13(20-17-9)16-14(19)15-11-3-4-12-10(8-11)5-6-18(12)2/h3-8H,1-2H3,(H2,15,16,19) |
| InChIKey | USFUFHFQWXDVMH-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. |
| Applications: | serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. receptor modulator A drug that acts as an antagonist, agonist, reverse agonist, or in some other fashion when interacting with cellular receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-(1-methylindol-5-yl)-3-(3-methyl-1,2-thiazol-5-yl)urea (CHEBI:140936) has role receptor modulator (CHEBI:90710) |
| 1-(1-methylindol-5-yl)-3-(3-methyl-1,2-thiazol-5-yl)urea (CHEBI:140936) has role serotonergic antagonist (CHEBI:48279) |
| 1-(1-methylindol-5-yl)-3-(3-methyl-1,2-thiazol-5-yl)urea (CHEBI:140936) is a 1,2-thiazoles (CHEBI:48902) |
| 1-(1-methylindol-5-yl)-3-(3-methyl-1,2-thiazol-5-yl)urea (CHEBI:140936) is a indoles (CHEBI:24828) |
| 1-(1-methylindol-5-yl)-3-(3-methyl-1,2-thiazol-5-yl)urea (CHEBI:140936) is a ureas (CHEBI:47857) |
| IUPAC Name |
|---|
| 1-(1-methyl-1H-indol-5-yl)-3-(3-methyl-1,2-thiazol-5-yl)urea |
| Synonyms | Source |
|---|---|
| 3-(3-methyl-1,2-thiazol-5-yl)-1-(1-methylindol-5-yl)urea | SUBMITTER |
| N-(1-methyl-1H-5-indolyl)-N'-(3-methyl-5-isothiazolyl)urea | SUBMITTER |
| N-(1-methyl-5-indolyl)-N'-(3-methyl-5-isothiazolyl)urea | ChEBI |
| SB 204741 | ChEBI |
| SB-204741 | ChEBI |
| SB204741 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| SB-204741 | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:152239-46-8 | SUBMITTER |
| Citations |
|---|