EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H34O5 |
| Net Charge | 0 |
| Average Mass | 354.487 |
| Monoisotopic Mass | 354.24062 |
| SMILES | CCCCC/C=C\C[C@@H]1[C@H](/C=C/C(O)CCCC(=O)O)[C@@H](O)C[C@H]1O |
| InChI | InChI=1S/C20H34O5/c1-2-3-4-5-6-7-10-16-17(19(23)14-18(16)22)13-12-15(21)9-8-11-20(24)25/h6-7,12-13,15-19,21-23H,2-5,8-11,14H2,1H3,(H,24,25)/b7-6-,13-12+/t15?,16-,17+,18-,19+/m1/s1 |
| InChIKey | RZCPXIZGLPAGEV-SUHLLOIRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | urine (BTO:0001419) | MetaboLights (MTBLS8662) |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-iPF2α-VI (CHEBI:140933) is a prostanoid (CHEBI:26347) |
| Incoming Relation(s) |
| (+/-)5-iPF2alpha-VI(1-) (CHEBI:747144) is conjugate base of 5-iPF2α-VI (CHEBI:140933) |
| IUPAC Name |
|---|
| (E)-7-[(1S,2R,3R,5S)-3,5-dihydroxy-2-[(Z)-oct-2-enyl]cyclopentyl]-5-hydroxyhept-6-enoic acid |
| Synonyms | Source |
|---|---|
| (+/-)5-iPF2alpha-VI | ChEBI |
| 5-iPF2a-VI | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMFA03110011 | LIPID MAPS |