EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32O5 |
| Net Charge | 0 |
| Average Mass | 352.471 |
| Monoisotopic Mass | 352.22497 |
| SMILES | CCCCC[C@H](O)/C=C/[C@H]1[C@@H](O)CC(=O)[C@@H]1C/C=C\CCCC(=O)O |
| InChI | InChI=1S/C20H32O5/c1-2-3-6-9-15(21)12-13-17-16(18(22)14-19(17)23)10-7-4-5-8-11-20(24)25/h4,7,12-13,15-17,19,21,23H,2-3,5-6,8-11,14H2,1H3,(H,24,25)/b7-4-,13-12+/t15-,16+,17+,19-/m0/s1 |
| InChIKey | XEYBRNLFEZDVAW-YUOXZBOXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood plasma (BTO:0000118) | PubMed (20671299) | |
| Mus musculus (ncbitaxon:10090) | lung (BTO:0000763) | PubMed (23662178) | |
| Rattus norvegicus (ncbitaxon:10116) | lung (BTO:0000763) | PubMed (23662178) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | rat metabolite Any mammalian metabolite produced during a metabolic reaction in rat (Rattus norvegicus). mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 11β-PGE2 (CHEBI:140932) has role human metabolite (CHEBI:77746) |
| 11β-PGE2 (CHEBI:140932) has role mouse metabolite (CHEBI:75771) |
| 11β-PGE2 (CHEBI:140932) has role rat metabolite (CHEBI:86264) |
| 11β-PGE2 (CHEBI:140932) is a cyclic ketone (CHEBI:3992) |
| 11β-PGE2 (CHEBI:140932) is a diol (CHEBI:23824) |
| 11β-PGE2 (CHEBI:140932) is a hydroxy monocarboxylic acid (CHEBI:35868) |
| 11β-PGE2 (CHEBI:140932) is a prostanoid (CHEBI:26347) |
| 11β-PGE2 (CHEBI:140932) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| (5Z,13E,15S)-11β,15-dihydroxy-9-oxoprosta-5,13-dien-1-oic acid |
| Synonyms | Source |
|---|---|
| 11-epi-prostaglandin E2 | ChEBI |
| (5Z,13E,15S)-11β,15-dihydroxy-9-oxo-5,13-prostadiene-1-oic acid | ChEBI |
| (5Z,13E,15S)-9-oxo-11β,15-dihydroxyprosta-5,13-diene-1-oic acid | ChEBI |
| 11beta-PGE2 | LIPID MAPS |
| 11β-prostaglandin E2 | ChEBI |
| 11-epi PGE2 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMFA03010060 | LIPID MAPS |
| HMDB0060041 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:38310-90-6 | ChEBI |
| Citations |
|---|