EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H14N4OS |
| Net Charge | 0 |
| Average Mass | 274.349 |
| Monoisotopic Mass | 274.08883 |
| SMILES | c1coc(-c2nnc3sc(C4CCCCC4)nn23)c1 |
| InChI | InChI=1S/C13H14N4OS/c1-2-5-9(6-3-1)12-16-17-11(10-7-4-8-18-10)14-15-13(17)19-12/h4,7-9H,1-3,5-6H2 |
| InChIKey | SWTUPSNBTSPBIH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | Wnt signalling inhibitor A substance that inhibits any of the Wnt signalling pathway, a group of signal transduction pathways made of proteins that pass signals from outside of a cell through cell surface receptors to the inside of the cell. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cardionogen-1 (CHEBI:140909) has role Wnt signalling inhibitor (CHEBI:78031) |
| cardionogen-1 (CHEBI:140909) is a furans (CHEBI:24129) |
| cardionogen-1 (CHEBI:140909) is a triazolothiadiazole (CHEBI:140920) |
| IUPAC Name |
|---|
| 6-cyclohexyl-3-(2-furyl)[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
| Synonyms | Source |
|---|---|
| 6-cyclohexyl-3-furan-2-yl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole | ChEBI |
| CDNG-1 | ChEBI |
| CDNG1 | ChEBI |
| vuc230 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 329824737 | PubChem Compound |
| Registry Numbers | Sources |
|---|---|
| CAS:577696-37-8 | SUBMITTER |
| Citations |
|---|