EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H35N5 |
| Net Charge | 0 |
| Average Mass | 429.612 |
| Monoisotopic Mass | 429.28925 |
| SMILES | CN(C)c1ccccc1CN1CCCN(Cc2ccccc2N(C)C)C1c1ccncc1 |
| InChI | InChI=1S/C27H35N5/c1-29(2)25-12-7-5-10-23(25)20-31-18-9-19-32(27(31)22-14-16-28-17-15-22)21-24-11-6-8-13-26(24)30(3)4/h5-8,10-17,27H,9,18-21H2,1-4H3 |
| InChIKey | KVQOGDQTWWCZFX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | Hedgehog signaling pathway inhibitor Any pathway inhibitor that inhibits the Hedgehog signalling pathway. glioma-associated oncogene inhibitor An inhibitor of any of the glioma-associated oncogene (GLI) proteins. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| GANT61 (CHEBI:140908) has role antineoplastic agent (CHEBI:35610) |
| GANT61 (CHEBI:140908) has role apoptosis inducer (CHEBI:68495) |
| GANT61 (CHEBI:140908) has role glioma-associated oncogene inhibitor (CHEBI:140922) |
| GANT61 (CHEBI:140908) has role Hedgehog signaling pathway inhibitor (CHEBI:140921) |
| GANT61 (CHEBI:140908) is a aminal (CHEBI:35412) |
| GANT61 (CHEBI:140908) is a pyridines (CHEBI:26421) |
| GANT61 (CHEBI:140908) is a substituted aniline (CHEBI:48975) |
| GANT61 (CHEBI:140908) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| 2-({3-[2-(dimethylamino)benzyl]-2-(pyridin-4-yl)tetrahydropyrimidin-1(2H)-yl}methyl)-N,N-dimethylaniline |
| Synonyms | Source |
|---|---|
| NSC 136476 | SUBMITTER |
| GANT-61 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:500579-04-4 | SUBMITTER |
| Citations |
|---|