EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H39NO |
| Net Charge | 0 |
| Average Mass | 345.571 |
| Monoisotopic Mass | 345.30316 |
| SMILES | CCCCCCCCCCCCCCCC(=O)NCc1ccccc1 |
| InChI | InChI=1S/C23H39NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-17-20-23(25)24-21-22-18-15-14-16-19-22/h14-16,18-19H,2-13,17,20-21H2,1H3,(H,24,25) |
| InChIKey | MLGPKWUKOQAAGI-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Lepidium meyenii (ncbitaxon:153348) | - | DOI (doi.org/0.1080/10942912.2016.1274905) |
| Roles Classification |
|---|
| Biological Roles: | EC 3.5.1.99 (fatty acid amide hydrolase) inhibitor An EC 3.5.1.* (non-peptide linear amide C-N hydrolase) inhibitor that interferes with the action of fatty acid amide hydrolase (EC 3.5.1.99). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-benzylhexadecanamide (CHEBI:140849) has functional parent benzylamine (CHEBI:40538) |
| N-benzylhexadecanamide (CHEBI:140849) has functional parent hexadecanoic acid (CHEBI:15756) |
| N-benzylhexadecanamide (CHEBI:140849) has role EC 3.5.1.99 (fatty acid amide hydrolase) inhibitor (CHEBI:64033) |
| N-benzylhexadecanamide (CHEBI:140849) has role neuroprotective agent (CHEBI:63726) |
| N-benzylhexadecanamide (CHEBI:140849) has role plant metabolite (CHEBI:76924) |
| N-benzylhexadecanamide (CHEBI:140849) is a macamide (CHEBI:140939) |
| N-benzylhexadecanamide (CHEBI:140849) is a secondary carboxamide (CHEBI:140325) |
| IUPAC Name |
|---|
| N-benzylhexadecanamide |
| Synonyms | Source |
|---|---|
| macamide 1 | ChemIDplus |
| N-benzylpalmitamide | ChemIDplus |
| N-(phenylmethyl)-hexadecanamide | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:74058-71-2 | ChemIDplus |
| CAS:74058-71-2 | NIST Chemistry WebBook |
| Citations |
|---|