EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H24NO7 |
| Net Charge | -1 |
| Average Mass | 390.412 |
| Monoisotopic Mass | 390.15583 |
| SMILES | C[C@H](CCC(=O)[O-])O[C@@H]1O[C@@H](C)[C@H](OC(=O)c2cnc3ccccc23)C[C@H]1O |
| InChI | InChI=1S/C20H25NO7/c1-11(7-8-18(23)24)26-20-16(22)9-17(12(2)27-20)28-19(25)14-10-21-15-6-4-3-5-13(14)15/h3-6,10-12,16-17,20-22H,7-9H2,1-2H3,(H,23,24)/p-1/t11-,12+,16-,17-,20-/m1/s1 |
| InChIKey | GIZBXORWWXIWKX-VEZRURDRSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| icas#9(1−) (CHEBI:140804) has functional parent ascr#9(1−) (CHEBI:139714) |
| icas#9(1−) (CHEBI:140804) is a monocarboxylic acid anion (CHEBI:35757) |
| icas#9(1−) (CHEBI:140804) is conjugate base of icas#9 (CHEBI:79028) |
| Incoming Relation(s) |
| icas#9 (CHEBI:79028) is conjugate acid of icas#9(1−) (CHEBI:140804) |
| IUPAC Name |
|---|
| (4R)-4-{[3,6-dideoxy-4-O-(1H-indol-3-ylcarbonyl)-α-L-arabino-hexopyranosyl]oxy}pentanoate |
| Synonyms | Source |
|---|---|
| icas#9 anion | ChEBI |
| IC-asc-C5(1−) | ChEBI |
| IC-asc-C5 anion | ChEBI |