EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H16N4 |
| Net Charge | 0 |
| Average Mass | 168.244 |
| Monoisotopic Mass | 168.13750 |
| SMILES | C1CN2CN3CCN(CN1C3)C2 |
| InChI | InChI=1S/C8H16N4/c1-2-10-7-11-3-4-12(8-10)6-9(1)5-11/h1-8H2 |
| InChIKey | YHNNUDUEGSHVGJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | disinfectant An antimicrobial agent that is applied to non-living objects to destroy harmful microorganisms or to inhibit their activity. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,3,6,8-tetraazatricyclo[4,4,1,13,8]dodecane (CHEBI:140779) has role disinfectant (CHEBI:48219) |
| 1,3,6,8-tetraazatricyclo[4,4,1,13,8]dodecane (CHEBI:140779) is a adamanzane (CHEBI:140780) |
| IUPAC Name |
|---|
| 1,3,6,8-tetraazatricyclo[4.4.1.13,8]dodecane |
| Synonyms | Source |
|---|---|
| 1,6,3,8-dimethano-1,3,6,8-tetraazacyclodecane | ChEBI |
| 1,6,3,8-diméthano-tétra-aza-cyclodécane | ChEBI |
| 1,6,3,8-dimethan-tetra-aza-cyclodecane | ChEBI |
| [14.22]adz | ChEBI |
| TATD | ChemIDplus |
| tetraazatricyclododecane | ChEBI |
| Brand Name | Source |
|---|---|
| Dezant | ChemIDplus |
| Citations |
|---|