EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H30O14 |
| Net Charge | 0 |
| Average Mass | 614.556 |
| Monoisotopic Mass | 614.16356 |
| SMILES | O=C(O)CC(C1=C(O)C(O)(C2OC(CO)C(O)C(O)C2O)C(=O)C(C(=O)/C=C/c2ccc(O)cc2)=C1O)c1ccc(O)cc1 |
| InChI | InChI=1S/C30H30O14/c31-12-19-23(37)25(39)26(40)29(44-19)30(43)27(41)21(17(11-20(35)36)14-4-8-16(33)9-5-14)24(38)22(28(30)42)18(34)10-3-13-1-6-15(32)7-2-13/h1-10,17,19,23,25-26,29,31-33,37-41,43H,11-12H2,(H,35,36)/b10-3+ |
| InChIKey | CCEKPTFNQKNHKZ-XCVCLJGOSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Safflomin C (CHEBI:140765) is a diarylheptanoid (CHEBI:78802) |
| Manual Xrefs | Databases |
|---|---|
| LMPK12120408 | LIPID MAPS |
| HMDB0034052 | HMDB |