EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H30O12 |
| Net Charge | 0 |
| Average Mass | 522.503 |
| Monoisotopic Mass | 522.17373 |
| SMILES | C[C@H]1O[C@@H](Oc2c3c(c(O[C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)c4ccccc24)C=COC3)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C25H30O12/c1-10-16(27)18(29)20(31)24(34-10)37-23-12-5-3-2-4-11(12)22(13-6-7-33-9-14(13)23)36-25-21(32)19(30)17(28)15(8-26)35-25/h2-7,10,15-21,24-32H,8-9H2,1H3/t10-,15-,16-,17-,18+,19+,20-,21-,24+,25+/m1/s1 |
| InChIKey | JRJWTHQYOKFMNP-BSKDJEKXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mitracarpus scaber (IPNI:756246-1) | aerial part (BTO:0001658) | Article (Molecules, 2018, 23, 1237) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| clarinoside (CHEBI:140715) has role anti-inflammatory agent (CHEBI:67079) |
| clarinoside (CHEBI:140715) has role plant metabolite (CHEBI:76924) |
| clarinoside (CHEBI:140715) is a naphthopyran (CHEBI:86027) |
| clarinoside (CHEBI:140715) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| 5-(β-D-glucopyranosyloxy)-1H-naphtho[2,3-c]pyran-10-yl 6-deoxy-β-D-glucopyranoside |
| Synonyms | Source |
|---|---|
| 5,10-dihydroxy-2H-naphtho[2,3-b]pyran-5-β-D-glucopyranosyl-10-β-D-quinovopyranoside | ChEBI |
| 5-(β-D-glucopyranosyloxy)-1H-naphtho[2,3-c]pyran-10-yl β-D-quinovopyranoside | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:32869939 | Reaxys |
| Citations |
|---|