EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H19F3N2O4S2 |
| Net Charge | 0 |
| Average Mass | 448.488 |
| Monoisotopic Mass | 448.07383 |
| SMILES | O=S(=O)(NC1CCNCC1)c1cc(S(=O)(=O)c2ccccc2)ccc1C(F)(F)F |
| InChI | InChI=1S/C18H19F3N2O4S2/c19-18(20,21)16-7-6-15(28(24,25)14-4-2-1-3-5-14)12-17(16)29(26,27)23-13-8-10-22-11-9-13/h1-7,12-13,22-23H,8-11H2 |
| InChIKey | ITBGJNVZJBVPLJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | secreted frizzled-related protein 1 inhibitor Any inhibitor of secreted frizzled-related protein 1 (SFRP1). The level of SFRP1 affects osteoblast apoptosis and proliferation, so SFRP1 inhibitors have the potential to be used for the treatment of osteoporosis or other bone related disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| WAY-316606 (CHEBI:140700) has role secreted frizzled-related protein 1 inhibitor (CHEBI:140701) |
| WAY-316606 (CHEBI:140700) is a (trifluoromethyl)benzenes (CHEBI:83565) |
| WAY-316606 (CHEBI:140700) is a piperidines (CHEBI:26151) |
| WAY-316606 (CHEBI:140700) is a secondary amino compound (CHEBI:50995) |
| WAY-316606 (CHEBI:140700) is a sulfonamide (CHEBI:35358) |
| WAY-316606 (CHEBI:140700) is a sulfone (CHEBI:35850) |
| IUPAC Name |
|---|
| 5-(phenylsulfonyl)-N-(piperidin-4-yl)-2-(trifluoromethyl)benzenesulfonamide |
| Synonyms | Source |
|---|---|
| WAY 316606 | ChEBI |
| 5-(phenylsulfonyl)-N-4-piperidinyl-2-(trifluoromethyl)benzene sulfonamide | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:19311858 | Reaxys |
| Citations |
|---|