EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H42O3 |
| Net Charge | 0 |
| Average Mass | 342.564 |
| Monoisotopic Mass | 342.31340 |
| SMILES | CC(O)CCCCCCCCCCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C21H42O3/c1-20(22)18-16-14-12-10-8-6-4-2-3-5-7-9-11-13-15-17-19-21(23)24/h20,22H,2-19H2,1H3,(H,23,24) |
| InChIKey | KEELWVJBLPISGL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 20-hydroxyhenicosanoic acid (CHEBI:140696) has functional parent henicosanoic acid (CHEBI:39248) |
| 20-hydroxyhenicosanoic acid (CHEBI:140696) is a (ω−1)-hydroxy fatty acid (CHEBI:78954) |
| 20-hydroxyhenicosanoic acid (CHEBI:140696) is a long-chain fatty acid (CHEBI:15904) |
| 20-hydroxyhenicosanoic acid (CHEBI:140696) is a secondary alcohol (CHEBI:35681) |
| 20-hydroxyhenicosanoic acid (CHEBI:140696) is a straight-chain saturated fatty acid (CHEBI:39418) |
| 20-hydroxyhenicosanoic acid (CHEBI:140696) is conjugate acid of 20-hydroxyhenicosanoate (CHEBI:140697) |
| Incoming Relation(s) |
| (20R)-20-hydroxyhenicosanoic acid (CHEBI:79017) is a 20-hydroxyhenicosanoic acid (CHEBI:140696) |
| 20-hydroxyhenicosanoate (CHEBI:140697) is conjugate base of 20-hydroxyhenicosanoic acid (CHEBI:140696) |
| IUPAC Name |
|---|
| 20-hydroxyhenicosanoic acid |