EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H14N2O |
| Net Charge | 0 |
| Average Mass | 130.191 |
| Monoisotopic Mass | 130.11061 |
| SMILES | CCCCCN(C)N=O |
| InChI | InChI=1S/C6H14N2O/c1-3-4-5-6-8(2)7-9/h3-6H2,1-2H3 |
| InChIKey | KSFCDINBDBFFSI-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-methyl-N-pentylnitrosamine (CHEBI:140674) has role carcinogenic agent (CHEBI:50903) |
| N-methyl-N-pentylnitrosamine (CHEBI:140674) is a nitrosamine (CHEBI:35803) |
| IUPAC Name |
|---|
| N-methyl-N-pentylnitrous amide |
| Synonyms | Source |
|---|---|
| AMN | ChemIDplus |
| N-amyl-N-methylnitrosamine | ChemIDplus |
| N-methyl-N-nitrosopentylamine | ChemIDplus |
| N-nitroso-N-methyl-n-amylamine | ChemIDplus |
| Methylamylnitrosamin | ChemIDplus |
| methylamylnitrosamine | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| Methyl-n-amylnitrosamine | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1925624 | Reaxys |
| CAS:13256-07-0 | ChemIDplus |
| Citations |
|---|