EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H19NO4 |
| Net Charge | 0 |
| Average Mass | 349.386 |
| Monoisotopic Mass | 349.13141 |
| SMILES | COc1ccc2c(c1OC)CN(C)c1c-2ccc2cc3c(cc12)OCO3 |
| InChI | InChI=1S/C21H19NO4/c1-22-10-16-13(6-7-17(23-2)21(16)24-3)14-5-4-12-8-18-19(26-11-25-18)9-15(12)20(14)22/h4-9H,10-11H2,1-3H3 |
| InChIKey | ALZAZMCIBRHMFF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dihydrochelerythrine (CHEBI:140672) is a benzophenanthridine alkaloid (CHEBI:38517) |
| Manual Xrefs | Databases |
|---|---|
| 425346 | ChemSpider |