EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H20N2O5 |
| Net Charge | 0 |
| Average Mass | 332.356 |
| Monoisotopic Mass | 332.13722 |
| SMILES | [C-]#[N+]/C=C/c1ccc(O[C@H]2O[C@@H](C)[C@@H](NC(C)=O)[C@@H](O)[C@@H]2O)cc1 |
| InChI | InChI=1S/C17H20N2O5/c1-10-14(19-11(2)20)15(21)16(22)17(23-10)24-13-6-4-12(5-7-13)8-9-18-3/h4-10,14-17,21-22H,1-2H3,(H,19,20)/b9-8+/t10-,14+,15+,16-,17+/m0/s1 |
| InChIKey | WQBVZBBQNNMLLX-YFFNFLMJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Xenorhabdus nematophila (ncbitaxon:628) | - | PubMed (22711807) | |
| Photorhabdus luminescens (ncbitaxon:29488) | - | PubMed (22711807) |
| Roles Classification |
|---|
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. EC 1.14.18.1 (tyrosinase) inhibitor Any EC 1.14.18.* (oxidoreductase acting on paired donors, miscellaneous compound as one donor, incorporating 1 atom of oxygen) inhibitor that interferes with the action of tyrosinase (monophenol monooxygenase), EC 1.14.18.1, an enzyme that catalyses the oxidation of phenols (such as tyrosine) and is widespread in plants and animals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rhabduscin (CHEBI:140651) has role bacterial metabolite (CHEBI:76969) |
| rhabduscin (CHEBI:140651) has role EC 1.14.18.1 (tyrosinase) inhibitor (CHEBI:59997) |
| rhabduscin (CHEBI:140651) is a acetamides (CHEBI:22160) |
| rhabduscin (CHEBI:140651) is a isocyanide (CHEBI:35353) |
| rhabduscin (CHEBI:140651) is a olefinic compound (CHEBI:78840) |
| IUPAC Name |
|---|
| 4-[(E)-2-isocyanovinyl]phenyl 4-acetamido-4,6-dideoxy-β-L-galactopyranoside |
| Manual Xrefs | Databases |
|---|---|
| CPD-20771 | MetaCyc |
| Citations |
|---|