EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | (C8H6O5)n.HO |
| Net Charge | -1 |
| Average Mass | 199.138 |
| Monoisotopic Mass | 199.02481 |
| SMILES | [H]OCCOC(=O)c1ccc(C(=O)[O-])o1 |
| InChI | InChI=1S/C8H8O6/c9-3-4-13-8(12)6-2-1-5(14-6)7(10)11/h1-2,9H,3-4H2,(H,10,11)/p-1 |
| InChIKey | TVAULEXYEOZOPM-UHFFFAOYSA-M |
| Wikipedia |
|---|
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| poly(2,5-ethylene furandicarboxylate)(1−) (CHEBI:140646) is a ionic polymer (CHEBI:60164) |
| poly(2,5-ethylene furandicarboxylate)(1−) (CHEBI:140646) is conjugate base of poly(2,5-ethylene furandicarboxylate) (CHEBI:55310) |
| Incoming Relation(s) |
| poly(2,5-ethylene furandicarboxylate) (CHEBI:55310) is conjugate acid of poly(2,5-ethylene furandicarboxylate)(1−) (CHEBI:140646) |
| UniProt Name | Source |
|---|---|
| poly(2,5-ethylene furandicarboxylate) | UniProt |
| Manual Xrefs | Databases |
|---|---|
| Polyethylene_2,5-furandicarboxylate | Wikipedia |
| Citations |
|---|