EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H18NO7P |
| Net Charge | 0 |
| Average Mass | 331.261 |
| Monoisotopic Mass | 331.08209 |
| SMILES | O=C(O)CCCCCP(=O)(O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C13H18NO7P/c15-13(16)4-2-1-3-9-22(19,20)21-10-11-5-7-12(8-6-11)14(17)18/h5-8H,1-4,9-10H2,(H,15,16)(H,19,20) |
| InChIKey | ARWNSSBHKYKVRY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-{hydroxy[(4-nitrobenzyl)oxy]phosphoryl}hexanoic acid (CHEBI:140643) is a C-nitro compound (CHEBI:35716) |
| 6-{hydroxy[(4-nitrobenzyl)oxy]phosphoryl}hexanoic acid (CHEBI:140643) is a carboxylic acid (CHEBI:33575) |
| 6-{hydroxy[(4-nitrobenzyl)oxy]phosphoryl}hexanoic acid (CHEBI:140643) is a phosphonic ester (CHEBI:37735) |
| IUPAC Name |
|---|
| 6-{hydroxy[(4-nitrobenzyl)oxy]phosphoryl}hexanoic acid |
| Synonym | Source |
|---|---|
| 6-[hydroxy[(4-nitrophenyl)methoxy]phosphinyl]hexanoic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8639551 | Reaxys |
| Citations |
|---|