EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:140628 - secnidazole
| Formula | C7H11N3O3 |
| Net Charge | 0 |
| Average Mass | 185.183 |
| Monoisotopic Mass | 185.08004 |
| SMILES | Cc1ncc([N+](=O)[O-])n1CC(C)O |
| InChI | InChI=1S/C7H11N3O3/c1-5(11)4-9-6(2)8-3-7(9)10(12)13/h3,5,11H,4H2,1-2H3 |
| InChIKey | KPQZUUQMTUIKBP-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | epitope The biological role played by a material entity when bound by a receptor of the adaptive immune system. Specific site on an antigen to which an antibody binds. antiprotozoal drug Any antimicrobial drug which is used to treat or prevent protozoal infections. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| Application: | antiprotozoal drug Any antimicrobial drug which is used to treat or prevent protozoal infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| secnidazole (CHEBI:140628) has role antibacterial agent (CHEBI:33282) |
| secnidazole (CHEBI:140628) has role antiprotozoal drug (CHEBI:35820) |
| secnidazole (CHEBI:140628) has role epitope (CHEBI:53000) |
| secnidazole (CHEBI:140628) is a C-nitro compound (CHEBI:35716) |
| secnidazole (CHEBI:140628) is a imidazoles (CHEBI:24780) |
| secnidazole (CHEBI:140628) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| 1-(2-methyl-5-nitro-1H-imidazol-1-yl)propan-2-ol |
| INNs | Source |
|---|---|
| secnidazol | WHO MedNet |
| secnidazole | ChemIDplus |
| secnidazole | WHO MedNet |
| secnidazolum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 1-(2-methyl-5-nitro-1-imidazolyl)-2-propanol | ChEBI |
| PM-185184 | DrugBank |
| RP 14539 | DrugBank |
| RP-14539 | DrugBank |
| SYM-1219 | DrugBank |
| Brand Names | Source |
|---|---|
| Flagentyl | DrugCentral |
| Secnidal | KEGG DRUG |
| Solosec | KEGG DRUG |
| Citations |
|---|