EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H11N3O3 |
| Net Charge | 0 |
| Average Mass | 185.183 |
| Monoisotopic Mass | 185.08004 |
| SMILES | Cc1ncc([N+](=O)[O-])n1CC(C)O |
| InChI | InChI=1S/C7H11N3O3/c1-5(11)4-9-6(2)8-3-7(9)10(12)13/h3,5,11H,4H2,1-2H3 |
| InChIKey | KPQZUUQMTUIKBP-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antiprotozoal drug Any antimicrobial drug which is used to treat or prevent protozoal infections. epitope The biological role played by a material entity when bound by a receptor of the adaptive immune system. Specific site on an antigen to which an antibody binds. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| Application: | antiprotozoal drug Any antimicrobial drug which is used to treat or prevent protozoal infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| secnidazole (CHEBI:140628) has role antibacterial agent (CHEBI:33282) |
| secnidazole (CHEBI:140628) has role antiprotozoal drug (CHEBI:35820) |
| secnidazole (CHEBI:140628) has role epitope (CHEBI:53000) |
| secnidazole (CHEBI:140628) is a C-nitro compound (CHEBI:35716) |
| secnidazole (CHEBI:140628) is a imidazoles (CHEBI:24780) |
| secnidazole (CHEBI:140628) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| 1-(2-methyl-5-nitro-1H-imidazol-1-yl)propan-2-ol |
| INNs | Source |
|---|---|
| secnidazol | WHO MedNet |
| secnidazole | ChemIDplus |
| secnidazole | WHO MedNet |
| secnidazolum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 1-(2-methyl-5-nitro-1-imidazolyl)-2-propanol | ChEBI |
| PM-185184 | DrugBank |
| RP 14539 | DrugBank |
| RP-14539 | DrugBank |
| SYM-1219 | DrugBank |
| Brand Names | Source |
|---|---|
| Flagentyl | DrugCentral |
| Secnidal | KEGG DRUG |
| Solosec | KEGG DRUG |
| Citations |
|---|