EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H32O2 |
| Net Charge | 0 |
| Average Mass | 316.485 |
| Monoisotopic Mass | 316.24023 |
| SMILES | CCC/C=C\C/C=C\CCCCCCCc1cccc(O)c1O |
| InChI | InChI=1S/C21H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-16-19-17-15-18-20(22)21(19)23/h4-5,7-8,15,17-18,22-23H,2-3,6,9-14,16H2,1H3/b5-4-,8-7- |
| InChIKey | RMTXUPIIESNLPW-UTOQUPLUSA-N |
| Roles Classification |
|---|
| Biological Role: | allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (8Z,11Z)-urushiol III (CHEBI:140612) has role allergen (CHEBI:50904) |
| (8Z,11Z)-urushiol III (CHEBI:140612) is a catechols (CHEBI:33566) |
| IUPAC Name |
|---|
| 3-[(8Z,11Z)-pentadeca-8,11-dien-1-yl]benzene-1,2-diol |
| Synonyms | Source |
|---|---|
| urushiol (C15:2) | ChEBI |
| urushiol III | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:83258-37-1 | ChemIDplus |
| Citations |
|---|