EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H31N3O3 |
| Net Charge | 0 |
| Average Mass | 409.530 |
| Monoisotopic Mass | 409.23654 |
| SMILES | CC(C)c1cc(C(=O)N2Cc3ccc(CN4CCN(C)CC4)cc3C2)c(O)cc1O |
| InChI | InChI=1S/C24H31N3O3/c1-16(2)20-11-21(23(29)12-22(20)28)24(30)27-14-18-5-4-17(10-19(18)15-27)13-26-8-6-25(3)7-9-26/h4-5,10-12,16,28-29H,6-9,13-15H2,1-3H3 |
| InChIKey | IFRGXKKQHBVPCQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | Hsp90 inhibitor An EC 3.6.4.10 (non-chaperonin molecular chaperone ATPase) inhibitor that blocks the action of heat shock protein 90. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| onalespib (CHEBI:140592) has role antineoplastic agent (CHEBI:35610) |
| onalespib (CHEBI:140592) has role Hsp90 inhibitor (CHEBI:63962) |
| onalespib (CHEBI:140592) is a N-alkylpiperazine (CHEBI:46845) |
| onalespib (CHEBI:140592) is a benzamides (CHEBI:22702) |
| onalespib (CHEBI:140592) is a isoindoles (CHEBI:24897) |
| onalespib (CHEBI:140592) is a resorcinols (CHEBI:33572) |
| onalespib (CHEBI:140592) is a tertiary carboxamide (CHEBI:140326) |
| IUPAC Name |
|---|
| (2,4-dihydroxy-5-isopropylphenyl){5-[(4-methylpiperazin-1-yl)methyl]-1,3-dihydro-2H-isoindol-2-yl}methanone |
| INNs | Source |
|---|---|
| onalespib | ChemIDplus |
| onalespib | WHO MedNet |
| onalespib | WHO MedNet |
| onalespibum | WHO MedNet |
| Synonyms | Source |
|---|---|
| (2,4-dihydroxy-5-isopropylphenyl)-(5-(4-methylpiperazin-1-ylmethyl)-1,3-dihydroisoindol-2-yl)methanone | SUBMITTER |
| AT 13387 | ChemIDplus |
| AT-13387 | ChemIDplus |
| AT13387 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:18536397 | Reaxys |
| CAS:912999-49-6 | ChemIDplus |
| Citations |
|---|