EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H11BrNO3.Na |
| Net Charge | 0 |
| Average Mass | 356.151 |
| Monoisotopic Mass | 354.98200 |
| SMILES | Nc1c(CC(=O)[O-])cccc1C(=O)c1ccc(Br)cc1.[Na+] |
| InChI | InChI=1S/C15H12BrNO3.Na/c16-11-6-4-9(5-7-11)15(20)12-3-1-2-10(14(12)17)8-13(18)19;/h1-7H,8,17H2,(H,18,19);/q;+1/p-1 |
| InChIKey | HZFGMQJYAFHESD-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Role: | non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. |
| Applications: | non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bromfenac sodium salt (CHEBI:140536) has part bromfenac(1−) (CHEBI:59175) |
| bromfenac sodium salt (CHEBI:140536) has role non-narcotic analgesic (CHEBI:35481) |
| bromfenac sodium salt (CHEBI:140536) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| bromfenac sodium salt (CHEBI:140536) is a organic sodium salt (CHEBI:38700) |
| Incoming Relation(s) |
| bromfenac sodium salt sesquihydrate (CHEBI:59176) has part bromfenac sodium salt (CHEBI:140536) |
| IUPAC Name |
|---|
| sodium [2-amino-3-(4-bromobenzoyl)phenyl]acetate |
| Synonyms | Source |
|---|---|
| bromfenac sodium | ChemIDplus |
| Sodium; [2-amino-3-(4-bromo-benzoyl)-phenyl]-acetate | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| Beilstein:6034130 | Beilstein |
| CAS:91714-93-1 | ChemIDplus |