EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H25N5O15P2 |
| Net Charge | 0 |
| Average Mass | 589.344 |
| Monoisotopic Mass | 589.08224 |
| SMILES | C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](n3cnc4c(=O)nc(N)nc43)[C@H](O)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C16H25N5O15P2/c1-4-7(22)9(24)11(26)15(33-4)35-38(30,31)36-37(28,29)32-2-5-8(23)10(25)14(34-5)21-3-18-6-12(21)19-16(17)20-13(6)27/h3-5,7-11,14-15,22-26H,2H2,1H3,(H,28,29)(H,30,31)(H3,17,19,20,27)/t4-,5-,7-,8-,9-,10-,11+,14-,15-/m1/s1 |
| InChIKey | LQEBEXMHBLQMDB-AVOXIQDMSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| GDP-6-deoxy-α-D-altrose (CHEBI:140531) is a GDP-hexose (CHEBI:21167) |
| GDP-6-deoxy-α-D-altrose (CHEBI:140531) is conjugate acid of GDP-6-deoxy-α-D-altrose(2−) (CHEBI:140433) |
| Incoming Relation(s) |
| GDP-6-deoxy-α-D-altrose(2−) (CHEBI:140433) is conjugate base of GDP-6-deoxy-α-D-altrose (CHEBI:140531) |
| IUPAC Name |
|---|
| guanosine 5'-[3-(6-deoxy-α-D-altropyranosyl) dihydrogen diphosphate] |
| Manual Xrefs | Databases |
|---|---|
| CPD-20462 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:19213343 | Reaxys |