EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H11ClN2O2 |
| Net Charge | 0 |
| Average Mass | 238.674 |
| Monoisotopic Mass | 238.05091 |
| SMILES | NC(Cc1cnc2cc(Cl)ccc12)C(=O)O |
| InChI | InChI=1S/C11H11ClN2O2/c12-7-1-2-8-6(3-9(13)11(15)16)5-14-10(8)4-7/h1-2,4-5,9,14H,3,13H2,(H,15,16) |
| InChIKey | FICLVQOYKYBXFN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-chlorotryptophan (CHEBI:140516) is a non-proteinogenic α-amino acid (CHEBI:83925) |
| 6-chlorotryptophan (CHEBI:140516) is a organochlorine compound (CHEBI:36683) |
| 6-chlorotryptophan (CHEBI:140516) is a tryptophan derivative (CHEBI:27164) |
| Incoming Relation(s) |
| 6-chloro-D-tryptophan (CHEBI:140515) is a 6-chlorotryptophan (CHEBI:140516) |