EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H11ClN2O2 |
| Net Charge | 0 |
| Average Mass | 238.674 |
| Monoisotopic Mass | 238.05091 |
| SMILES | [NH3+][C@H](Cc1cnc2cc(Cl)ccc12)C(=O)[O-] |
| InChI | InChI=1S/C11H11ClN2O2/c12-7-1-2-8-6(3-9(13)11(15)16)5-14-10(8)4-7/h1-2,4-5,9,14H,3,13H2,(H,15,16)/t9-/m1/s1 |
| InChIKey | FICLVQOYKYBXFN-SECBINFHSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-chloro-D-tryptophan zwitterion (CHEBI:140509) is a α-amino-acid zwitterion (CHEBI:78608) |
| 6-chloro-D-tryptophan zwitterion (CHEBI:140509) is tautomer of 6-chloro-D-tryptophan (CHEBI:140515) |
| Incoming Relation(s) |
| 6-chloro-D-tryptophan (CHEBI:140515) is tautomer of 6-chloro-D-tryptophan zwitterion (CHEBI:140509) |
| IUPAC Name |
|---|
| (2R)-2-ammonio-3-(6-chloro-1H-indol-3-yl)propanoate |
| Synonym | Source |
|---|---|
| (2R)-2-ammonio-3-(6-chloro-1H-indol-3-yl)propionate | ChEBI |
| UniProt Name | Source |
|---|---|
| 6-chloro-D-tryptophan | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-21264 | MetaCyc |