EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | Al2O7Si2.2H2O |
| Net Charge | 0 |
| Average Mass | 258.159 |
| Monoisotopic Mass | 257.90246 |
| SMILES | O.O.[O]=[Al][O][Si](=O)O[Si](=O)[O][Al]=[O] |
| InChI | InChI=1S/2Al.O5Si2.2H2O.2O/c;;1-6(2)5-7(3)4;;;;/h;;;2*1H2;;/q2*+1;-2;;;; |
| InChIKey | NLYAJNPCOHFWQQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | antidiarrhoeal drug Any drug found useful in the symptomatic treatment of diarrhoea. excipient A generally pharmacologically inactive substance that is formulated with the active ingredient of a medication. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| kaolin (CHEBI:140503) has part kaolinite (CHEBI:140499) |
| kaolin (CHEBI:140503) has role antidiarrhoeal drug (CHEBI:55323) |
| kaolin (CHEBI:140503) has role excipient (CHEBI:75324) |
| kaolin (CHEBI:140503) is a aluminosilicate mineral (CHEBI:48730) |
| kaolin (CHEBI:140503) is a mixture (CHEBI:60004) |
| Synonyms | Source |
|---|---|
| China clay | ChemIDplus |
| porcelain clay | ChemIDplus |
| argilla | ChemIDplus |
| Bolus alba | ChemIDplus |
| white bole | ChemIDplus |
| Citations |
|---|