EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H15FN2O3 |
| Net Charge | 0 |
| Average Mass | 314.316 |
| Monoisotopic Mass | 314.10667 |
| SMILES | [H]C(C(=O)NO)=C([H])c1ccc(C([H])=C([H])C(=O)c2cccc(F)c2)n1C |
| InChI | InChI=1S/C17H15FN2O3/c1-20-14(5-6-15(20)8-10-17(22)19-23)7-9-16(21)12-3-2-4-13(18)11-12/h2-11,23H,1H3,(H,19,22) |
| InChIKey | QQDIFLSJMFDTCQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 3.5.1.98 (histone deacetylase) inhibitor An EC 3.5.1.* (non-peptide linear amide C-N hydrolase) inhibitor that interferes with the function of histone deacetylase (EC 3.5.1.98). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| MC1568 (CHEBI:140475) has role EC 3.5.1.98 (histone deacetylase) inhibitor (CHEBI:61115) |
| MC1568 (CHEBI:140475) is a aromatic ketone (CHEBI:76224) |
| MC1568 (CHEBI:140475) is a enone (CHEBI:51689) |
| MC1568 (CHEBI:140475) is a hydroxamic acid (CHEBI:24650) |
| MC1568 (CHEBI:140475) is a monofluorobenzenes (CHEBI:83575) |
| MC1568 (CHEBI:140475) is a pyrroles (CHEBI:26455) |
| IUPAC Name |
|---|
| 3-{5-[3-(3-fluorophenyl)-3-oxoprop-1-en-1-yl]-1-methyl-1H-pyrrol-2-yl}-N-hydroxyacrylamide |
| Synonym | Source |
|---|---|
| MC-1568 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:26700969 | Reaxys |
| CAS:852475-26-4 | SUBMITTER |
| Citations |
|---|