EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H21N3O3S |
| Net Charge | 0 |
| Average Mass | 407.495 |
| Monoisotopic Mass | 407.13036 |
| SMILES | O=C(Nc1ccccc1C(=O)NC1CCCCNC1=O)c1cc2ccccc2s1 |
| InChI | InChI=1S/C22H21N3O3S/c26-20(25-17-10-5-6-12-23-21(17)27)15-8-2-3-9-16(15)24-22(28)19-13-14-7-1-4-11-18(14)29-19/h1-4,7-9,11,13,17H,5-6,10,12H2,(H,23,27)(H,24,28)(H,25,26) |
| InChIKey | TUSCYCAIGRVBMD-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | tropomyosin-related kinase B receptor antagonist An antagonist that binds to and deactivates the tropomyosin-related kinase B (TrkB) receptor, the main signaling receptor of the neurotrophin brain-derived neurotrophic factor (BDNF). |
| Applications: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ANA-12 (CHEBI:140465) has functional parent 2-aminohexano-6-lactam (CHEBI:19471) |
| ANA-12 (CHEBI:140465) has functional parent anthranilic acid (CHEBI:30754) |
| ANA-12 (CHEBI:140465) has role antidepressant (CHEBI:35469) |
| ANA-12 (CHEBI:140465) has role anxiolytic drug (CHEBI:35474) |
| ANA-12 (CHEBI:140465) has role tropomyosin-related kinase B receptor antagonist (CHEBI:78681) |
| ANA-12 (CHEBI:140465) is a 1-benzothiophenes (CHEBI:38836) |
| ANA-12 (CHEBI:140465) is a caprolactams (CHEBI:23000) |
| ANA-12 (CHEBI:140465) is a secondary carboxamide (CHEBI:140325) |
| IUPAC Name |
|---|
| N-{2-[(2-oxoazepan-3-yl)carbamoyl]phenyl}-1-benzothiophene-2-carboxamide |
| Synonyms | Source |
|---|---|
| ANA12 | ChEBI |
| TrkB antagonist | SUBMITTER |
| Manual Xrefs | Databases |
|---|---|
| ANA-12 | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:29788980 | Reaxys |
| CAS:219766-25-3 | Wikipedia |
| Citations |
|---|