EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H21NO5 |
| Net Charge | 0 |
| Average Mass | 235.280 |
| Monoisotopic Mass | 235.14197 |
| SMILES | C[C@@H]1O[C@@H](OCCCCN)[C@@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C10H21NO5/c1-6-7(12)8(13)9(14)10(16-6)15-5-3-2-4-11/h6-10,12-14H,2-5,11H2,1H3/t6-,7+,8+,9-,10+/m0/s1 |
| InChIKey | HJVUQIHMNQMRIV-LOLPMWEVSA-N |
| Roles Classification |
|---|
| Biological Role: | allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-aminobutyl α-L-fucopyranoside (CHEBI:140447) has functional parent α-L-fucose (CHEBI:42548) |
| 4-aminobutyl α-L-fucopyranoside (CHEBI:140447) has role allergen (CHEBI:50904) |
| 4-aminobutyl α-L-fucopyranoside (CHEBI:140447) is a glycoside (CHEBI:24400) |
| IUPAC Name |
|---|
| 4-aminobutyl α-L-fucopyranoside |
| Synonyms | Source |
|---|---|
| AFG | ChEBI |
| 4-aminobutyl 6-deoxy-α-L-galactopyranoside | IUPAC |
| Citations |
|---|