EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H24N2 |
| Net Charge | 0 |
| Average Mass | 304.437 |
| Monoisotopic Mass | 304.19395 |
| SMILES | [H][C@@]12c3c(nc4ccccc34)C(C)(C)[C@@]1([H])CC[C@@](C)(C=C)[C@@H]2[N+]#[C-] |
| InChI | InChI=1S/C21H24N2/c1-6-21(4)12-11-14-17(19(21)22-5)16-13-9-7-8-10-15(13)23-18(16)20(14,2)3/h6-10,14,17,19,23H,1,11-12H2,2-4H3/t14-,17-,19+,21+/m0/s1 |
| InChIKey | NEYJIGPAQAKWSI-QBGRRASTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Hapalosiphon welwitschii (ncbitaxon:1433842) | - | PubMed (27348090) | Strain: UTEX B 1830 |
| Roles Classification |
|---|
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 12-epi-fischerindole U (CHEBI:140442) has role bacterial metabolite (CHEBI:76969) |
| 12-epi-fischerindole U (CHEBI:140442) is a fischerindole alkaloid (CHEBI:141619) |
| 12-epi-fischerindole U (CHEBI:140442) is a isocyanide (CHEBI:35353) |
| 12-epi-fischerindole U (CHEBI:140442) is a organic heterotetracyclic compound (CHEBI:38163) |
| Synonym | Source |
|---|---|
| (6aS,9S,10R,10aS)-9-ethenyl-10-isocyano-6,6,9-trimethyl-5H,6aH,7H,8H,10H,10aH-indeno[2,1-b]indole | SUBMITTER |
| UniProt Name | Source |
|---|---|
| 12-epi-fischerindole U | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-20797 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7144608 | Reaxys |
| Citations |
|---|