EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H24N2 |
| Net Charge | 0 |
| Average Mass | 304.437 |
| Monoisotopic Mass | 304.19395 |
| SMILES | [H][C@@]12CC[C@](C)(C=C)[C@H]([N+]#[C-])[C@@]1([H])c1cnc3cccc(c13)C2(C)C |
| InChI | InChI=1S/C21H24N2/c1-6-21(4)11-10-15-18(19(21)22-5)13-12-23-16-9-7-8-14(17(13)16)20(15,2)3/h6-9,12,15,18-19,23H,1,10-11H2,2-4H3/t15-,18+,19-,21+/m1/s1 |
| InChIKey | SLUFHMQYBPOTFZ-LKRGOLFISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Fischerella ambigua (ncbitaxon:230521) | - | PubMed (19371071) | Strain: UTEX 1903 |
| Fischerella muscicola (ncbitaxon:83542) | - | PubMed (22863526) | Strain: UTEX 1829 |
| Hapalosiphon delicatulus (ncbitaxon:210996) | - | PubMed (9784177) | UH isolate IC-13-1 |
| Westiellopsis sp. (ncbitaxon:1521509) | - | PubMed (22863526) | Strain: SAG 20.93 |
| Roles Classification |
|---|
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hapalindole H (CHEBI:140440) has role bacterial metabolite (CHEBI:76969) |
| hapalindole H (CHEBI:140440) is a hapalindole (CHEBI:141617) |
| hapalindole H (CHEBI:140440) is a isocyanide (CHEBI:35353) |
| hapalindole H (CHEBI:140440) is a organic heterotetracyclic compound (CHEBI:38163) |
| IUPAC Name |
|---|
| (6aR,9R,10R,10aR)-9-ethenyl-10-isocyano-6,6,9-trimethyl-2,2a,6,6a,7,8,9,10,10a,10c-decahydronaphtho[1,2,3-cd]indole |
| UniProt Name | Source |
|---|---|
| hapalindole H | UniProt |
| Citations |
|---|