EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H8N2 |
| Net Charge | 0 |
| Average Mass | 168.199 |
| Monoisotopic Mass | 168.06875 |
| SMILES | [C-]#[N+]/C=C\c1cnc2ccccc12 |
| InChI | InChI=1S/C11H8N2/c1-12-7-6-9-8-13-11-5-3-2-4-10(9)11/h2-8,13H/b7-6- |
| InChIKey | JQMYMZZLIOIXEO-SREVYHEPSA-N |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-[(Z)-2-isocyanovinyl]indole (CHEBI:140434) has role antibacterial agent (CHEBI:33282) |
| 3-[(Z)-2-isocyanovinyl]indole (CHEBI:140434) has role bacterial metabolite (CHEBI:76969) |
| 3-[(Z)-2-isocyanovinyl]indole (CHEBI:140434) is a 3-(2-isocyanovinyl)indole (CHEBI:144370) |
| IUPAC Name |
|---|
| 3-[(Z)-2-isocyanoethenyl]-1H-indole |
| Synonyms | Source |
|---|---|
| antibiotic B-371 | ChEBI |
| B-371 | ChEBI |
| cis-indolyl vinyl isonitrile | ChEBI |
| (Z)-2-(1H-indol-3-yl)vinyl isocyanide | ChEBI |
| (Z) indolyl vinyl isonitrile | ChEBI |
| UniProt Name | Source |
|---|---|
| 3-[(Z)-2-isocyanoethenyl]-1H-indole | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-20769 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| CAS:61168-06-7 | ChEBI |
| Citations |
|---|