EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H26NO2PS |
| Net Charge | 0 |
| Average Mass | 267.375 |
| Monoisotopic Mass | 267.14219 |
| SMILES | CCN(CC)CCSP(C)(=O)OCC(C)C |
| InChI | InChI=1S/C11H26NO2PS/c1-6-12(7-2)8-9-16-15(5,13)14-10-11(3)4/h11H,6-10H2,1-5H3 |
| InChIKey | MNLAVFKVRUQAKW-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | neurotoxin A poison that interferes with the functions of the nervous system. EC 3.1.1.7 (acetylcholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of enzyme acetylcholinesterase (EC 3.1.1.7), which helps breaking down of acetylcholine into choline and acetic acid. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| VR nerve agent (CHEBI:140422) has role EC 3.1.1.7 (acetylcholinesterase) inhibitor (CHEBI:38462) |
| VR nerve agent (CHEBI:140422) has role neurotoxin (CHEBI:50910) |
| VR nerve agent (CHEBI:140422) is a organic thiophosphate (CHEBI:37512) |
| VR nerve agent (CHEBI:140422) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| S-[2-(diethylamino)ethyl] O-(2-methylpropyl) methylphosphonothioate |
| Synonyms | Source |
|---|---|
| O-isobutyl S-[2-(diethylamino)ethyl] methylphosphonothioate | ChEBI |
| O-(iso-butyl) S-(2-diethylaminoethyl) methylphosphonothiolate | NIST Chemistry WebBook |
| R 33 | ChemIDplus |
| R-33 | ChemIDplus |
| Russian VX | ChemIDplus |
| R-VX | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| VR_(nerve_agent) | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:159939-87-4 | NIST Chemistry WebBook |
| CAS:159939-87-4 | ChemIDplus |
| Citations |
|---|