EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H22ClN5O3 |
| Net Charge | 0 |
| Average Mass | 451.914 |
| Monoisotopic Mass | 451.14112 |
| SMILES | COc1ccc(NC(=O)c2ccc(C(=N)N(C)C)cc2)c(C(=O)Nc2ccc(Cl)cn2)c1 |
| InChI | InChI=1S/C23H22ClN5O3/c1-29(2)21(25)14-4-6-15(7-5-14)22(30)27-19-10-9-17(32-3)12-18(19)23(31)28-20-11-8-16(24)13-26-20/h4-13,25H,1-3H3,(H,27,30)(H,26,28,31) |
| InChIKey | XHOLNRLADUSQLD-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 3.4.21.6 (coagulation factor Xa) inhibitor An EC 3.4.21.* (serine endopeptidase) inhibitor that interferes with the action of coagulation factor Xa (EC 3.4.21.6). |
| Applications: | anti-arrhythmia drug A drug used for the treatment or prevention of cardiac arrhythmias. Anti-arrhythmia drugs may affect the polarisation-repolarisation phase of the action potential, its excitability or refractoriness, or impulse conduction or membrane responsiveness within cardiac fibres. anticoagulant An agent that prevents blood clotting. renoprotective agent Any compound that is able to prevent damage to the kidneys. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| betrixaban (CHEBI:140421) has role anti-arrhythmia drug (CHEBI:38070) |
| betrixaban (CHEBI:140421) has role anticoagulant (CHEBI:50249) |
| betrixaban (CHEBI:140421) has role EC 3.4.21.6 (coagulation factor Xa) inhibitor (CHEBI:68581) |
| betrixaban (CHEBI:140421) has role renoprotective agent (CHEBI:231911) |
| betrixaban (CHEBI:140421) is a benzamides (CHEBI:22702) |
| betrixaban (CHEBI:140421) is a guanidines (CHEBI:24436) |
| betrixaban (CHEBI:140421) is a monochloropyridine (CHEBI:39172) |
| betrixaban (CHEBI:140421) is a monomethoxybenzene (CHEBI:25235) |
| betrixaban (CHEBI:140421) is a secondary carboxamide (CHEBI:140325) |
| IUPAC Name |
|---|
| N-(5-chloropyridin-2-yl)-2-[4-(N,N-dimethylcarbamimidoyl)benzamido]-5-methoxybenzamide |
| INN | Source |
|---|---|
| betrixaban | ChemIDplus |
| Synonyms | Source |
|---|---|
| Betrixaban maleate | ChEMBL |
| PRT 054021 | ChemIDplus |
| PRT-054021 | ChEMBL |
| PRT054021 | ChemIDplus |
| Brand Name | Source |
|---|---|
| Bevyxxa | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| D08873 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| Reaxys:15486817 | Reaxys |
| CAS:330942-05-7 | ChemIDplus |
| Citations |
|---|