EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H22ClN5O3 |
| Net Charge | 0 |
| Average Mass | 451.914 |
| Monoisotopic Mass | 451.14112 |
| SMILES | COc1ccc(NC(=O)c2ccc(C(=N)N(C)C)cc2)c(C(=O)Nc2ccc(Cl)cn2)c1 |
| InChI | InChI=1S/C23H22ClN5O3/c1-29(2)21(25)14-4-6-15(7-5-14)22(30)27-19-10-9-17(32-3)12-18(19)23(31)28-20-11-8-16(24)13-26-20/h4-13,25H,1-3H3,(H,27,30)(H,26,28,31) |
| InChIKey | XHOLNRLADUSQLD-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 3.4.21.6 (coagulation factor Xa) inhibitor An EC 3.4.21.* (serine endopeptidase) inhibitor that interferes with the action of coagulation factor Xa (EC 3.4.21.6). |
| Application: | anticoagulant An agent that prevents blood clotting. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| betrixaban (CHEBI:140421) has role anticoagulant (CHEBI:50249) |
| betrixaban (CHEBI:140421) has role EC 3.4.21.6 (coagulation factor Xa) inhibitor (CHEBI:68581) |
| betrixaban (CHEBI:140421) is a benzamides (CHEBI:22702) |
| betrixaban (CHEBI:140421) is a guanidines (CHEBI:24436) |
| betrixaban (CHEBI:140421) is a monochloropyridine (CHEBI:39172) |
| betrixaban (CHEBI:140421) is a monomethoxybenzene (CHEBI:25235) |
| betrixaban (CHEBI:140421) is a secondary carboxamide (CHEBI:140325) |
| IUPAC Name |
|---|
| N-(5-chloropyridin-2-yl)-2-[4-(N,N-dimethylcarbamimidoyl)benzamido]-5-methoxybenzamide |
| INN | Source |
|---|---|
| betrixaban | ChemIDplus |
| Synonyms | Source |
|---|---|
| PRT 054021 | ChemIDplus |
| PRT054021 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| D08873 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| Reaxys:15486817 | Reaxys |
| CAS:330942-05-7 | ChemIDplus |
| Citations |
|---|