EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H22ClFN4O4 |
| Net Charge | 0 |
| Average Mass | 484.915 |
| Monoisotopic Mass | 484.13136 |
| SMILES | CO[C@@H]1C[C@H](C(=O)Nc2ccc(-n3ccccc3=O)cc2F)N(C(=O)Nc2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C24H22ClFN4O4/c1-34-18-13-21(30(14-18)24(33)27-16-7-5-15(25)6-8-16)23(32)28-20-10-9-17(12-19(20)26)29-11-3-2-4-22(29)31/h2-12,18,21H,13-14H2,1H3,(H,27,33)(H,28,32)/t18-,21-/m1/s1 |
| InChIKey | QQBKAVAGLMGMHI-WIYYLYMNSA-N |
| Roles Classification |
|---|
| Biological Roles: | serine protease inhibitor Any protease inhibitor that restricts the action of a serine protease. EC 3.4.21.6 (coagulation factor Xa) inhibitor An EC 3.4.21.* (serine endopeptidase) inhibitor that interferes with the action of coagulation factor Xa (EC 3.4.21.6). |
| Application: | anticoagulant An agent that prevents blood clotting. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| eribaxaban (CHEBI:140420) has role anticoagulant (CHEBI:50249) |
| eribaxaban (CHEBI:140420) has role EC 3.4.21.6 (coagulation factor Xa) inhibitor (CHEBI:68581) |
| eribaxaban (CHEBI:140420) has role serine protease inhibitor (CHEBI:64926) |
| eribaxaban (CHEBI:140420) is a monochlorobenzenes (CHEBI:83403) |
| eribaxaban (CHEBI:140420) is a monofluorobenzenes (CHEBI:83575) |
| eribaxaban (CHEBI:140420) is a pyridone (CHEBI:38183) |
| eribaxaban (CHEBI:140420) is a pyrrolidines (CHEBI:38260) |
| eribaxaban (CHEBI:140420) is a secondary carboxamide (CHEBI:140325) |
| eribaxaban (CHEBI:140420) is a ureas (CHEBI:47857) |
| IUPAC Name |
|---|
| (2R,4R)-N1-(4-chlorophenyl)-N2-[2-fluoro-4-(2-oxopyridin-1(2H)-yl)phenyl]-4-methoxypyrrolidine-1,2-dicarboxamide |
| INNs | Source |
|---|---|
| eribaxaban | ChemIDplus |
| eribaxabán | WHO MedNet |
| éribaxaban | WHO MedNet |
| eribaxabanum | WHO MedNet |
| Synonyms | Source |
|---|---|
| PD 0348292 | ChemIDplus |
| PD-0348292 | ChemIDplus |
| PD0348292 | ChemIDplus |
| PD 348,292 | ChemIDplus |
| PD 348292 | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:12467251 | Reaxys |
| CAS:536748-46-6 | ChemIDplus |
| Citations |
|---|