EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H8INO3 |
| Net Charge | 0 |
| Average Mass | 305.071 |
| Monoisotopic Mass | 304.95489 |
| SMILES | O=C(O)CNC(=O)c1ccccc1I |
| InChI | InChI=1S/C9H8INO3/c10-7-4-2-1-3-6(7)9(14)11-5-8(12)13/h1-4H,5H2,(H,11,14)(H,12,13) |
| InChIKey | CORFWQGVBFFZHF-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-iodohippuric acid (CHEBI:140408) is a N-acylglycine (CHEBI:16180) |
| 2-iodohippuric acid (CHEBI:140408) is a benzamides (CHEBI:22702) |
| 2-iodohippuric acid (CHEBI:140408) is a organoiodine compound (CHEBI:37142) |
| 2-iodohippuric acid (CHEBI:140408) is conjugate acid of 2-iodohippurate (CHEBI:140410) |
| Incoming Relation(s) |
| 2-iodohippurate (CHEBI:140410) is conjugate base of 2-iodohippuric acid (CHEBI:140408) |
| Synonyms | Source |
|---|---|
| 2-(2-iodobenzamido)acetic acid | ChEBI |
| N-(2-iodobenzoyl)glycine | ChemIDplus |
| N-(o-iodobenzoyl)glycine | ChEBI |
| o-iodobenzoylglycine | ChEBI |
| o-iodohippuric acid | ChemIDplus |
| ortho-iodobenzoylglycine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| Ortho-iodohippurate | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1877943 | Reaxys |
| CAS:147-58-0 | ChemIDplus |
| Citations |
|---|